CAS 57960-31-3: 2-dodecyl-3-hydroxynaphthalene-1,4-dione
Description:2-Dodecyl-3-hydroxynaphthalene-1,4-dione, with the CAS number 57960-31-3, is an organic compound characterized by its naphthalene structure substituted with a dodecyl group and a hydroxyl group. This compound features a naphthoquinone moiety, which is known for its potential biological activity, including antioxidant properties. The presence of the long-chain dodecyl group enhances its lipophilicity, making it more soluble in non-polar solvents and potentially influencing its interaction with biological membranes. The hydroxyl group contributes to its reactivity and can participate in hydrogen bonding, affecting its solubility and stability in various environments. This compound may be of interest in fields such as materials science, organic synthesis, and medicinal chemistry due to its unique structural features and potential applications. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C22H30O3
InChI:InChI=1/C22H30O3/c1-2-3-4-5-6-7-8-9-10-11-16-19-20(23)17-14-12-13-15-18(17)21(24)22(19)25/h12-15,25H,2-11,16H2,1H3
- Synonyms:
- 1,4-Naphthalenedione, 2-Dodecyl-3-Hydroxy-
- 2-Dodecyl-3-hydroxy-1,4-naphthoquinone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Acequinocyl-hydroxy REF: 04-C10010520CAS: 57960-31-3 | - - - | 283.00 € | Mon 05 May 25 |
![]() | Acequinocyl-hydroxy REF: 3D-HCA96031CAS: 57960-31-3 | Min. 95% | To inquire | Fri 13 Jun 25 |

Acequinocyl-hydroxy
Controlled ProductRef: 04-C10010520
10mg | 283.00 € |

Acequinocyl-hydroxy
Ref: 3D-HCA96031
25mg | 1,057.00 € | ||
50mg | 1,386.00 € |