CAS 57960-84-6
:Ethyl 4-amino-α-ethylbenzeneacetate
Description:
Ethyl 4-amino-α-ethylbenzeneacetate, with the CAS number 57960-84-6, is an organic compound characterized by its ester functional group and an amino group attached to a benzene ring. This compound typically appears as a white to off-white solid or crystalline substance. It is soluble in organic solvents, such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Ethyl 4-amino-α-ethylbenzeneacetate may be utilized in various chemical syntheses or as an intermediate in the production of pharmaceuticals and agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment to mitigate exposure risks.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-3-11(12(14)15-4-2)9-5-7-10(13)8-6-9/h5-8,11H,3-4,13H2,1-2H3
InChI key:InChIKey=OXUCBZMQKBXZIC-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(CC)C1=CC=C(N)C=C1
Synonyms:- Ethyl 4-amino-α-ethylbenzeneacetate
- Ethyl 2-(4-aminophenyl)butyrate
- Benzeneacetic acid, 4-amino-α-ethyl-, ethyl ester
- Ethyl 2-(p-aminophenyl)butyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
