CAS 57962-45-5

(4-benzylmorpholin-2-yl)acetonitrile

Description:

(4-benzylmorpholin-2-yl)acetonitrile, with the CAS number 57962-45-5, is a chemical compound characterized by its morpholine ring structure, which is a six-membered heterocyclic compound containing one nitrogen atom. This substance features a benzyl group attached to the 4-position of the morpholine ring and an acetonitrile group at the 2-position. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the acetonitrile functional group imparts polar characteristics, making it soluble in polar solvents. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.

Formula: C₁₃H₁₆N₂O

InChI: InChI=1/C13H16N2O/c14-7-6-13-11-15(8-9-16-13)10-12-4-2-1-3-5-12/h1-5,13H,6,8-11H2

SMILES: c1ccc(cc1)CN1CCOC(CC#N)C1

(4-benzylmorpholin-2-yl)acetonitrile

CAS: 57962-45-5

Formula: C₁₃H₁₆N₂O

Purity: 95.0%

Color and Shape: Solid, Crystalline

Molecular weight: 216.284

Ref: 10-F312355