CAS 57963-09-4

6-(Phenylmethyl)-2-pyridinamine

Description:

6-(Phenylmethyl)-2-pyridinamine, with the CAS number 57963-09-4, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a phenylmethyl group (benzyl group) attached to the nitrogen of the pyridine, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of both polar and nonpolar functional groups. The compound may participate in various chemical reactions, such as nucleophilic substitutions or aromatic electrophilic substitutions, owing to the reactivity of the amine and the aromatic system. Additionally, it may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Its specific characteristics, such as melting point, boiling point, and spectral data, would need to be referenced from experimental sources for precise information.

Formula: C₁₂H₁₂N₂

InChI: InChI=1S/C12H12N2/c13-12-8-4-7-11(14-12)9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,13,14)

InChI key: InChIKey=HVYIQDPDESDLFU-UHFFFAOYSA-N

SMILES: C(C=1N=C(N)C=CC1)C2=CC=CC=C2

Synonyms:

• 6-Benzyl-2-pyridinamine
• 2-Pyridinamine, 6-(phenylmethyl)-
• 6-Benzylpyridin-2-amine
• 2-Amino-6-benzylpyridine
• 6-(Phenylmethyl)-2-pyridinamine

6-Benzylpyridin-2-amine

CAS: 57963-09-4

Formula: C₁₂H₁₂N₂

Molecular weight: 184.2371

Ref: IN-DA00EM1U

6-Benzylpyridin-2-amine

CAS: 57963-09-4

6-Benzylpyridin-2-amine is a synthetic compound that is used in the synthesis of isoquinoline derivatives. It has been shown to be a potent inhibitor of histamine N-methyltransferase, which is an enzyme involved in the regulation of histamine levels. 6-Benzylpyridin-2-amine inhibits both isoforms of this enzyme and has the potential to be developed as a drug for the treatment of allergies, asthma, or even schizophrenia.

Formula: C₁₂H₁₂N₂

Purity: Min. 95%

Molecular weight: 184.24 g/mol

Ref: 3D-HCA96309