CAS 57964-39-3
:4-(1-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
Description:
4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile, with the CAS number 57964-39-3, is a chemical compound characterized by its complex structure, which includes a naphthalene core substituted with cyano groups. This compound features a tetrahydronaphthalene moiety, indicating that it has a saturated naphthalene structure, which contributes to its stability and hydrophobic properties. The presence of cyano groups (-CN) suggests that it may exhibit polar characteristics, potentially influencing its solubility in various solvents. This compound may be of interest in organic synthesis and materials science due to its unique structural features, which could impart specific electronic or optical properties. Additionally, the cyano groups can participate in various chemical reactions, making this compound a potential candidate for further functionalization. Its applications may extend to pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on further research and development. As with any chemical, handling should be conducted with appropriate safety measures due to potential toxicity or reactivity.
Formula:C14H14N2
InChI:InChI=1/C14H14N2/c1-10(8-15)12-7-6-11(9-16)13-4-2-3-5-14(12)13/h2-5,10-12H,6-7H2,1H3
SMILES:CC(C#N)C1CCC(C#N)c2ccccc12
Synonyms:- 1-Naphthaleneacetonitrile, 4-cyano-1,2,3,4-tetrahydro-alpha-methyl-
- 2-[1-(4-Cyano-1,2,3,4-tetrahydronaphthyl)]propanenitrile
- 4-(1-Cyanoethyl)-1,2,3,4-tetrahydro-1-naphthalenecarbonitrile
- 4-Cyano-1,2,3,4-tetrahydro-alpha-methyl-1-naphthaleneacetonitrile
- Styrene-acrylonitrile trimer
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:Formula:C14H14N2Molecular weight:210.284-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:Applications 4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile is a component of the crude extract resulting from studies on the antifungal activity of Citrullus colocynthis against various plant pathogenic fungi.Oligomeric product in thermal polymerization of acrylonitrile/styrene system.
References Bokhari, N.A., et al.: J Pure Appl Microbio, 7, 2981-2986 (2013);Kirchner, K. et al. Macromolek Chem, 1976, 177, 2031-42.Formula:C14H14N2Color and Shape:White To Light YellowMolecular weight:210.274-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile is a synthetic organic compound, typically utilized in advanced chemical research and development. It is derived through a multi-step synthetic process involving the manipulation of naphthalene derivatives. The compound is characterized by the presence of cyano groups, influencing its reactivity and potential for further chemical transformations.Formula:C14H14N2Purity:Min. 95%Molecular weight:210.27 g/mol


