CAS 57964-40-6
:4-(2-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
Description:
4-(2-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile, with the CAS number 57964-40-6, is an organic compound characterized by its complex structure that includes a naphthalene core and multiple cyano groups. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and materials science. The presence of cyano groups contributes to its reactivity, making it useful in various chemical reactions, including nucleophilic additions and polymerization processes. Additionally, the tetrahydronaphthalene moiety imparts hydrophobic characteristics, which can influence its solubility in organic solvents. The compound's unique structure may also confer specific optical or electronic properties, making it of interest in the development of functional materials. Safety data sheets should be consulted for handling and storage guidelines, as compounds with cyano groups can be toxic and require careful management in laboratory settings. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C14H14N2
InChI:InChI=1/C14H14N2/c15-9-3-4-11-7-8-12(10-16)14-6-2-1-5-13(11)14/h1-2,5-6,11-12H,3-4,7-8H2
SMILES:c1ccc2C(CCC(CCC#N)c2c1)C#N
Synonyms:- 1-Naphthalenepropanenitrile, 4-cyano-1,2,3,4-tetrahydro-
- 3-[1-(4-Cyano-1,2,3,4-tetrahydronaphthyl)]propanenitrile
- 4-(2-Cyanoethyl)-1,2,3,4-tetrahydro-1-naphthalenecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(2-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:Formula:C14H14N2Color and Shape:Yellow SolidMolecular weight:210.284-(2-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:Formula:C14H14N2Molecular weight:210.27

