CAS 57993-25-6
:N-octadecanoyltyrosine
Description:
N-octadecanoyltyrosine, with the CAS number 57993-25-6, is a fatty acid derivative of the amino acid tyrosine. This compound features a long-chain fatty acid (octadecanoic acid, also known as stearic acid) covalently bonded to the tyrosine molecule, which contributes to its amphiphilic nature. The presence of the hydrophobic octadecanoyl group allows for interactions with lipid membranes, while the hydrophilic tyrosine moiety can engage in hydrogen bonding and other polar interactions. This dual characteristic makes N-octadecanoyltyrosine useful in various applications, including drug delivery systems, where it can enhance the solubility and bioavailability of hydrophobic drugs. Additionally, it may play a role in biochemical research, particularly in studies involving membrane dynamics and protein interactions. The compound is typically synthesized through acylation reactions and can be characterized using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.
Formula:C27H45NO4
InChI:InChI=1/C27H45NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(30)28-25(27(31)32)22-23-18-20-24(29)21-19-23/h18-21,25,29H,2-17,22H2,1H3,(H,28,30)(H,31,32)
Synonyms:- N-stearoyltyrosine
- L-Tyrosine, N-(1-oxooctadecyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Stearoyltyrosine
CAS:N-Stearoyltyrosine (N-(1-Oxooctadecyl)-L-tyrosine) is an analog of Anandamide. It exhibits neuroprotective effects by safeguarding the CA1 region of the hippocampus in a gerbil ischemia-reperfusion model. Additionally, N-Stearoyltyrosine inhibits free radical generation, enhances antioxidant capacity, and reduces IR-induced apoptosis (cell apoptosis).Formula:C27H45NO4Color and Shape:SolidMolecular weight:447.65
