CAS 58-18-4

Methyltestosterone

Description:

Methyltestosterone is a synthetic anabolic steroid and a derivative of testosterone, primarily used in medical settings to treat conditions such as testosterone deficiency and certain types of breast cancer. It is characterized by its chemical formula C20H30O2 and a molecular weight of approximately 302.46 g/mol. Methyltestosterone is known for its androgenic and anabolic properties, promoting muscle growth and enhancing physical performance. The substance is typically administered orally and is recognized for its relatively high bioavailability due to its methylation at the 17-alpha position, which protects it from hepatic metabolism. In terms of physical properties, it appears as a white to off-white crystalline powder, and it is soluble in organic solvents like ethanol and chloroform but has limited solubility in water. While it has legitimate medical uses, methyltestosterone is also associated with potential side effects, including hormonal imbalances and liver toxicity, and is classified as a controlled substance in many countries due to its potential for abuse in sports and bodybuilding.

Formula:C₂₀H₃₀O₂

InChI:InChI=1S/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h12,15-17,22H,4-11H2,1-3H3/t15-,16+,17+,18+,19+,20+/m1/s1

InChI key:InChIKey=GCKMFJBGXUYNAG-HLXURNFRSA-N

SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@](C)(O)CC4)[H])(CCC1=CC(=O)CC2)[H])[H]

Synonyms: