CAS 58-49-1
:(Val5)-Angiotensin II
Description:
(Val5)-Angiotensin II, also known as Valine 5-Angiotensin II, is a peptide that plays a crucial role in the regulation of blood pressure and fluid balance in the body. It is a modified form of the naturally occurring peptide angiotensin II, where the fifth amino acid is substituted with valine. This modification can influence its biological activity and receptor binding properties. Angiotensin II is primarily produced in the renin-angiotensin system and acts as a potent vasoconstrictor, promoting the release of aldosterone and increasing sodium reabsorption in the kidneys. The CAS number 58-49-1 identifies this specific compound, which is utilized in various research applications, particularly in studies related to cardiovascular physiology and pharmacology. Its characteristics include being a small peptide with a specific sequence of amino acids, which contributes to its biological function and interaction with angiotensin receptors. Understanding its properties is essential for exploring therapeutic interventions in conditions like hypertension and heart failure.
Formula:C49H69N13O12
InChI:InChI:1S/C49H69N13O12/c1-26(2)39(60-42(67)33(12-8-18-54-49(51)52)56-41(66)32(50)23-38(64)65)45(70)57-34(20-29-14-16-31(63)17-15-29)43(68)61-40(27(3)4)46(71)58-35(22-30-24-53-25-55-30)47(72)62-19-9-13-37(62)44(69)59-36(48(73)74)21-28-10-6-5-7-11-28/h5-7,10-11,14-17,24-27,32-37,39-40,63H,8-9,12-13,18-23,50H2,1-4H3,(H,53,55)(H,56,66)(H,57,70)(H,58,71)(H,59,69)(H,60,67)(H,61,68)(H,64,65)(H,73,74)(H4,51,52,54)
Synonyms:- H-Asp-Arg-Val-Tyr-Val-His-Pro-Phe-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Val5)-Angiotensin II H-Asp-Arg-Val-Tyr-Val-His-Pro-Phe-OH
CAS:Formula:C49H69N13O12Purity:99%Molecular weight:1032.1521Angiotensin II 5-valine
CAS:ngiotensin II 5-valine is an angiotensin II analog which is an agonist at angiotensin receptors.Formula:C49H69N13O12Purity:98%Color and Shape:SolidMolecular weight:N/A(Val⁵)-Angiotensin II
CAS:Bachem ID: 4008960.
Formula:C49H69N13O12Purity:99.7%Color and Shape:White PowderMolecular weight:1032.17




