CAS 58-60-6: Aminonucleoside
Description:Aminonucleoside, with the CAS number 58-60-6, is a chemical compound that belongs to the class of nucleosides, which are essential building blocks of nucleic acids like DNA and RNA. This substance is characterized by the presence of an amino group attached to a sugar moiety and a nitrogenous base. Aminonucleosides typically exhibit biological activity, often acting as intermediates in the synthesis of nucleotides or as potential therapeutic agents. They can influence various biochemical pathways, including those involved in cellular metabolism and genetic expression. The compound is soluble in water and may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. Its structural features allow it to participate in hydrogen bonding and other interactions, which are crucial for its biological functions. Due to its properties, aminonucleosides are of interest in medicinal chemistry and biochemistry, particularly in the development of antiviral and anticancer therapies.
Formula:C12H18N6O3
InChI:InChI=1S/C12H18N6O3/c1-17(2)10-8-11(15-4-14-10)18(5-16-8)12-9(20)7(13)6(3-19)21-12/h4-7,9,12,19-20H,3,13H2,1-2H3/t6-,7-,9-,12-/m1/s1
InChI key:InChIKey=RYSMHWILUNYBFW-GRIPGOBMSA-N
SMILES:OCC1OC(N2C=NC=3C2=NC=NC3N(C)C)C(O)C1N
- Synonyms:
- 3'-Amino-3'-deoxy-N6,N6-dimethyladenosine
- 3′-Amino-3′-deoxy-N<sup>6</sup>,N<sup>6</sup>-dimethyladenosine
- 6-(Dimethylamino)-9-(3-amino-3-deoxy-β-<span class="text-smallcaps">D</span>-ribofuranosyl)purine
- 6-Dimethylamino-9-(3'-ribosylamine)purine
- 6-Dimethylamino-9-(3-amino-3-deoxyribosyl)purine
- 9-(3-Amino-3-deoxy-β-<span class="text-smallcaps">D</span>-ribofuranosyl)-6-(dimethylamino)-9H-purine
- 9-(3-amino-3-deoxy-alpha-L-lyxofuranosyl)-N,N-dimethyl-9H-purin-6-amine
- 9-(3-amino-3-deoxypentofuranosyl)-N,N-dimethyl-9H-purin-6-amine
- Adenosine, 3'-amino-3'-deoxy-N,N-dimethyl-
- Aminonucleoside
- See more synonyms
- Aminonucleoside puromycin
- Ardma
- Brn 0093902
- Nsc 3056
- Puromycin aminonucleoside
- SAN
- Stylomycin aminonucleoside
- 3′-Amino-3′-deoxy-N,N-dimethyladenosine
- 4-26-00-03697 (Beilstein Handbook Reference)
