CAS 580-35-8
:2,4,6-Triphenylpyridine
Description:
2,4,6-Triphenylpyridine is an organic compound characterized by its structure, which consists of a pyridine ring substituted with three phenyl groups at the 2, 4, and 6 positions. This compound is typically a yellow to orange crystalline solid and is known for its stability and relatively low solubility in water, but it is soluble in organic solvents such as ethanol and acetone. It exhibits interesting photophysical properties, making it useful in various applications, including as a fluorescent probe and in organic light-emitting diodes (OLEDs). The presence of multiple phenyl groups contributes to its aromatic character and enhances its electron-accepting capabilities. Additionally, 2,4,6-Triphenylpyridine can participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions, which can lead to the formation of complexes. Its unique properties and versatility make it a subject of interest in both academic research and industrial applications.
Formula:C23H17N
InChI:InChI=1/C23H17N/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20/h1-17H
SMILES:c1ccc(cc1)c1cc(c2ccccc2)nc(c1)c1ccccc1
Synonyms:- Pyridine, 2,4,6-triphenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4,6-Triphenylpyridine
CAS:Formula:C23H17NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:307.402,4,6-Triphenylpyridine
CAS:2,4,6-Triphenylpyridine is an aromatic heterocycle with a benzyl group and trifluoroacetic acid at the 2-, 4-, and 6-positions. It is a colorless solid that has a melting point of 183 °C. In the gas phase, it exists as three anion radicals (2-, 4-, and 6-). These radicals are responsible for its optical properties. The 2-anion radical has a blue emission spectrum while the 4- and 6-anion radicals have red emission spectra. 2,4,6-Triphenylpyridine can be used as an indicator for trifluoroacetic acid or benzonitrile. It is soluble in primary alcohols such as methanol and ethanol at lower temperatures, but becomes insoluble at higher temperatures. 2,4,6-Triphenylpyridine also has functional theory applications due to its ability to
Formula:C23H17NPurity:Min. 95%Molecular weight:307.4 g/mol




