
CAS 580-74-5
:Xanthocillin X
Description:
Xanthocillin X is a natural product belonging to the class of compounds known as penicillin derivatives. It is characterized by its complex bicyclic structure, which includes a beta-lactam ring, a hallmark feature of penicillins that is crucial for its biological activity. This compound exhibits antibacterial properties, making it of interest in the field of medicinal chemistry. Xanthocillin X is produced by certain species of fungi, particularly those in the Penicillium genus, and is known for its ability to inhibit bacterial cell wall synthesis, thereby exerting its antimicrobial effects. The compound is typically studied for its potential therapeutic applications, especially in treating infections caused by susceptible bacteria. Additionally, Xanthocillin X may possess unique structural features that contribute to its efficacy and specificity against certain bacterial strains. Its chemical properties, such as solubility and stability, can vary depending on environmental conditions, which is important for its practical applications in pharmaceuticals.
Formula:C18H12N2O2
InChI:InChI=1S/C18H12N2O2/c1-19-17(11-13-3-7-15(21)8-4-13)18(20-2)12-14-5-9-16(22)10-6-14/h3-12,21-22H/b17-11-,18-12-
InChI key:InChIKey=YBMVKDUTYAGKEW-WHYMJUELSA-N
SMILES:C(\C(=C\C1=CC=C(O)C=C1)\[N+]#[C-])(=C/C2=CC=C(O)C=C2)/[N+]#[C-]
Synonyms:- Xanthocillin X
- Brevicide
- Phenol, 4,4′-[(1Z,3Z)-2,3-diisocyano-1,3-butadiene-1,4-diyl]bis-
- 4,4′-[(1Z,3Z)-2,3-Diisocyano-1,3-butadiene-1,4-diyl]bis[phenol]
- Ethylene isocyanide, bis(p-hydroxybenzylidene)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Xantocillin
CAS:Xanthocillin is a marine agent. Xanthocillin also induces autophagy through inhibition of the MEK/ERK pathway.Formula:C18H12N2O2Purity:98%Color and Shape:SolidMolecular weight:288.3Xantocillin
CAS:<p>Xantocillin is a broad-spectrum antimicrobial agent that has been shown to be active against a wide range of human pathogens. It contains a hydroxyl group in its chemical structure and is used to treat bowel diseases and infectious diseases. Xantocillin also has significant cytotoxicity, which means that it may cause damage to cells or tissues. The drug has been demonstrated to have significant cytotoxicity in animal models with plasma mass spectrometry. Xantocillin has been shown to kill bacteria by reacting with the fatty acid component of the bacterial cell membrane, which increases permeability, leading to cell death.</p>Formula:C18H12N2O2Purity:Min. 95%Molecular weight:288.3 g/mol

