CAS 58016-28-7
:Methyl olivetolate
Description:
Methyl olivetolate is an organic compound classified as a phenolic compound, specifically a methyl ester of olivetolic acid. It is characterized by its structure, which includes a phenolic ring and a long aliphatic chain, contributing to its hydrophobic properties. This compound is often associated with the biosynthesis of cannabinoids, particularly in plants like Cannabis sativa, where it plays a role in the formation of various cannabinoids. Methyl olivetolate is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The compound exhibits potential biological activities, including antimicrobial and antioxidant properties, making it of interest in both pharmacological and agricultural research. Additionally, its role in the biosynthetic pathways of cannabinoids has garnered attention in studies related to cannabis chemistry and potential therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks if ingested or improperly handled.
Formula:C13H18O4
InChI:InChI=1S/C13H18O4/c1-3-4-5-6-9-7-10(14)8-11(15)12(9)13(16)17-2/h7-8,14-15H,3-6H2,1-2H3
InChI key:InChIKey=RQGAOBDPFOADCM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CCCCC)C=C(O)C=C1O
Synonyms:- (6-Pentyl-2,4-dihydroxybenzoic acid methyl ester
- Methyl 2,4-Dihydroxy-6-Pentylbenzoate
- Methyl olivetolate
- Olivetolcarboxylic acid, methyl ether
- Benzoic acid, 2,4-dihydroxy-6-pentyl-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA00JNSD
1kgTo inquire1g26.00€5g31.00€10g56.00€25g82.00€50g126.00€100g176.00€250g364.00€500g571.00€Methyl 2,4-dihydroxy-6-pentylbenzoate
CAS:Methyl 2,4-dihydroxy-6-pentylbenzoateFormula:C13H18O4Purity:97%Color and Shape: light brown to yellow solidMolecular weight:238.28g/molMethyl 2,4-dihydroxy-6-pentylbenzoate
CAS:Methyl 2,4-dihydroxy-6-pentylbenzoate is a synthetic compound that is used as a precursor for the synthesis of natural products such as orsellinic acid. It is insoluble in water and soluble in organic solvents. Methyl 2,4-dihydroxy-6-pentylbenzoate has been used to synthesize cannabinoids and has demonstrated neuroprotective effects in mice. The compound has also been shown to have antimicrobial properties against methicillin resistant Staphylococcus aureus (MRSA) and Clostridium perfringens. Methyl 2,4-dihydroxy-6-pentylbenzoate is not active against acid fast bacteria such as Mycobacterium tuberculosis or Mycobacterium avium complex.
Formula:C13H18O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:238.28 g/molMethyl 2,4-dihydroxy-6-pentylbenzoate
CAS:Formula:C13H18O4Purity:96%Color and Shape:SolidMolecular weight:238.283Ref: 4Z-C-404001
Discontinued product




