CAS 5802-65-3

cyclopentane-1,1-dicarboxylic acid

Description:

Cyclopentane-1,1-dicarboxylic acid, with the CAS number 5802-65-3, is an organic compound characterized by its cyclopentane ring structure with two carboxylic acid functional groups attached to the first carbon atom. This dicarboxylic acid is a colorless, crystalline solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. The compound exhibits typical acid properties, including the ability to donate protons in solution, making it a weak acid. Its molecular structure allows for potential applications in organic synthesis, particularly in the production of polymers and as a building block for more complex molecules. Additionally, cyclopentane-1,1-dicarboxylic acid can participate in various chemical reactions, such as esterification and amidation, which are useful in the development of pharmaceuticals and agrochemicals. Overall, its unique structure and functional groups contribute to its versatility in chemical applications.

Formula: C₇H₁₀O₄

InChI: InChI=1/C7H10O4/c8-5(9)7(6(10)11)3-1-2-4-7/h1-4H2,(H,8,9)(H,10,11)

SMILES: C1CCC(C1)(C(=O)O)C(=O)O

Synonyms:

• 1,1-Cyclopentanedicarboxylic acid

Cyclopentane-1,1-dicarboxylic acid

CAS: 5802-65-3

Formula: C₇H₁₀O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.1519

Ref: IN-DA00EAG5

Cyclopentane-1,1-dicarboxylic acid

CAS: 5802-65-3

Cyclopentane-1,1-dicarboxylic acid

Purity: 95%

Molecular weight: 158.15g/mol

Ref: 54-OR945086

Cyclopentane-1,1-dicarboxylic acid

CAS: 5802-65-3

Formula: C₇H₁₀O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.153

Ref: 10-F066474