CAS 58022-21-2

1-(isoquinolin-1-yl)ethanone

Description:

1-(Isoquinolin-1-yl)ethanone, with the CAS number 58022-21-2, is an organic compound characterized by its isoquinoline structure fused with an ethanone functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It features a carbonyl group (C=O) attached to an ethyl group, which is further connected to an isoquinoline moiety, a bicyclic structure known for its aromatic properties. The presence of the isoquinoline ring imparts notable chemical stability and potential reactivity, making it of interest in various synthetic applications, particularly in medicinal chemistry. The compound may exhibit biological activity, which can be explored for potential pharmacological applications. Its solubility can vary based on the solvent used, and it may participate in typical organic reactions such as nucleophilic additions or substitutions due to the electrophilic nature of the carbonyl group. Overall, 1-(isoquinolin-1-yl)ethanone serves as a valuable building block in organic synthesis and drug development.

Formula: C₁₁H₉NO

InChI: InChI=1/C11H9NO/c1-8(13)11-10-5-3-2-4-9(10)6-7-12-11/h2-7H,1H3

SMILES: CC(=O)c1c2ccccc2ccn1

Synonyms:

• Ethanone, 1-(1-isoquinolinyl)-
• 1-(1-isoquinolinyl)-Ethanone
• 1-(Isoquinolin-1-yl)ethanone

1-Isoquinolin-1-yl-ethanone

CAS: 58022-21-2

Formula: C₁₁H₉NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 171.1953

Ref: IN-DA00EBQH

1-Isoquinolin-1-yl-ethanone

CAS: 58022-21-2

1-Isoquinolin-1-yl-ethanone

Purity: 99%

Molecular weight: 171.20g/mol

Ref: 54-OR72171

1-Isoquinolin-1-yl-ethanone

CAS: 58022-21-2

Formula: C₁₁H₉NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.199

Ref: 10-F046450

1-Isoquinolin-1-yl-ethanone

CAS: 58022-21-2

Versatile small molecule scaffold

Formula: C₁₁H₉NO

Purity: Min. 95%

Molecular weight: 171.2 g/mol

Ref: 3D-ICA02221