CAS 58028-74-3

2-(1H-pyrrol-1-yl)benzaldehyde

Description:

2-(1H-pyrrol-1-yl)benzaldehyde, with the CAS number 58028-74-3, is an organic compound characterized by the presence of both a pyrrole and an aldehyde functional group. This compound features a benzaldehyde moiety, where a pyrrole ring is substituted at the ortho position. It typically appears as a yellow to brown liquid or solid, depending on its purity and specific conditions. The compound is known for its aromatic properties, which contribute to its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. Its structure allows for various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, making it versatile in synthetic chemistry. Additionally, 2-(1H-pyrrol-1-yl)benzaldehyde may exhibit biological activity, which can be explored for potential therapeutic uses. As with many organic compounds, proper handling and safety precautions are essential due to its potential reactivity and toxicity.

Formula: C₁₁H₉NO

InChI: InChI=1/C11H9NO/c13-9-10-5-1-2-6-11(10)12-7-3-4-8-12/h1-9H

SMILES: c1ccc(c(c1)C=O)n1cccc1

Synonyms:

• benzaldehyde, 2-(1H-pyrrol-1-yl)-
• 2-(1H-PYRROL-1-YL)BENZALDEHYDE

2-Pyrrolidinobenzaldehyde

CAS: 58028-74-3

Formula: C₁₁H₁₃NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 175.2270

Ref: IN-DA003EPV

2-(Pyrrolidin-1-yl)benzaldehyde

CAS: 58028-74-3

2-(Pyrrolidin-1-yl)benzaldehyde

Purity: 97%

Molecular weight: 175.23g/mol

Ref: 54-OR9655

2-Pyrrolidin-1-yl-benzaldehyde

CAS: 58028-74-3

Formula: C₁₁H₁₃NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 175.231

Ref: 10-F059249

2-Pyrrolidin-1-yl-benzaldehyde

CAS: 58028-74-3

2-Pyrrolidin-1-yl-benzaldehyde is an acceptor molecule that can undergo a hydride transfer with a nucleophile. It is also able to undergo a nucleophilic attack on the carbonyl group, which is electrophilic. The benzaldehyde moiety has two lone pairs of electrons, which make it reactive enough to be used in biomolecular synthesis. 2-Pyrrolidin-1-yl-benzaldehyde also spontaneously converts into hexafluoroisopropanol (HFIP) and can be switched between its labile and stable form by changing the pH of the solution. The pyrrole ring is susceptible to oxidation, making it amenable to synthetic reactions. This molecule can also act as an amine donor in reactions where amines are needed as electron donors or acceptors.

Formula: C₁₁H₁₃NO

Purity: Min. 95%

Molecular weight: 175.23 g/mol

Ref: 3D-ICA02874