CAS 58028-76-5

2-morpholin-4-ylbenzaldehyde

Description:

2-Morpholin-4-ylbenzaldehyde is an organic compound characterized by the presence of a benzaldehyde group attached to a morpholine ring. Its molecular structure features a morpholine moiety, which is a six-membered heterocyclic compound containing one oxygen and one nitrogen atom, contributing to its unique chemical properties. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The presence of the aldehyde functional group allows for reactivity in various chemical reactions, such as condensation and reduction, making it a versatile intermediate in organic synthesis. Additionally, 2-morpholin-4-ylbenzaldehyde may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1/C11H13NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,9H,5-8H2

SMILES: c1ccc(c(c1)C=O)N1CCOCC1

Synonyms:

• 2-(Morpholin-4-yl)benzaldehyde
• Benzaldehyde, 2-(4-morpholinyl)-
• 2-Morpholinobenzaldehyde

2-Morpholinobenzaldehyde

CAS: 58028-76-5

Formula: C₁₁H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.2264

Ref: IN-DA003HR0

2-(Morpholin-4-yl)benzaldehyde

CAS: 58028-76-5

2-(Morpholin-4-yl)benzaldehyde

Formula: C₁₁H₁₃NO₂

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 191.23g/mol

Ref: 54-OR8138

2-Morpholin-4-yl-benzaldehyde

CAS: 58028-76-5

Formula: C₁₁H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.23

Ref: 10-F079881