CymitQuimica logo

CAS 5804-62-6

:

[5-amino-2-(octyloxy)phenyl]methanol

Description:
[5-amino-2-(octyloxy)phenyl]methanol, with the CAS number 5804-62-6, is an organic compound characterized by its phenolic structure, which includes an amino group and an octyloxy substituent. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and hydrophobic characteristics from the octyloxy chain. The presence of the amino group can impart basicity and reactivity, making it suitable for various chemical reactions, including nucleophilic substitutions. Additionally, the octyloxy group enhances the compound's lipophilicity, which may influence its biological activity and interaction with lipid membranes. This compound may be utilized in various applications, including pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be influenced by the length of the alkyl chain and the functional groups present.
Formula:C15H25NO2
InChI:InChI=1/C15H25NO2/c1-2-3-4-5-6-7-10-18-15-9-8-14(16)11-13(15)12-17/h8-9,11,17H,2-7,10,12,16H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.