CAS 5805-60-7

N-(1H-benzimidazol-2-ylmethyl)benzamide

Description:

N-(1H-benzimidazol-2-ylmethyl)benzamide, with the CAS number 5805-60-7, is a chemical compound characterized by its structure, which includes a benzimidazole moiety linked to a benzamide group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many benzimidazole derivatives. It may display biological activity, often being investigated for its potential as a pharmaceutical agent due to the presence of both the benzimidazole and amide functional groups, which can influence its interaction with biological targets. The compound's molecular structure allows for various types of intermolecular interactions, including hydrogen bonding and π-π stacking, which can affect its stability and reactivity. Additionally, it may possess fluorescence properties, making it useful in certain analytical applications. As with many organic compounds, its behavior can be influenced by environmental factors such as pH and temperature. Overall, N-(1H-benzimidazol-2-ylmethyl)benzamide is of interest in both synthetic chemistry and medicinal research.

Formula: C₁₅H₁₃N₃O

InChI: InChI=1/C15H13N3O/c19-15(11-6-2-1-3-7-11)16-10-14-17-12-8-4-5-9-13(12)18-14/h1-9H,10H2,(H,16,19)(H,17,18)

SMILES: c1ccc(cc1)C(=NCc1nc2ccccc2[nH]1)O

Synonyms:

• Benzamide, N-(1H-benzimidazol-2-ylmethyl)-
• N-(1H-Benzimidazol-2-ylmethyl)benzamide

N-[(1H-1,3-benzodiazol-2-yl)methyl]benzamide

CAS: 5805-60-7

Formula: C₁₅H₁₃N₃O

Molecular weight: 251.2832

Ref: IN-DA00EZUG

N-(1H-1,3-Benzodiazol-2-ylmethyl)benzamide

CAS: 5805-60-7

Versatile small molecule scaffold

Formula: C₁₅H₁₃N₃O

Purity: Min. 95%

Molecular weight: 251.28 g/mol

Ref: 3D-FAA80560