CAS 58050-17-2
:Crocetin β-D-glucosyl ester
Description:
Crocetin β-D-glucosyl ester, with the CAS number 58050-17-2, is a glycosylated derivative of crocetin, a carotenoid compound primarily found in saffron. This substance exhibits a yellow-orange color and is known for its potential health benefits, including antioxidant and anti-inflammatory properties. The glycosylation enhances its solubility in water, which may improve its bioavailability and efficacy in biological systems. Crocetin itself is recognized for its role in various physiological processes, including modulation of cellular signaling pathways. The β-D-glucosyl ester form may also exhibit different pharmacokinetic properties compared to its parent compound, potentially influencing its therapeutic applications. Additionally, crocetin derivatives are being studied for their potential use in food, cosmetics, and pharmaceuticals due to their natural origin and beneficial effects. Overall, Crocetin β-D-glucosyl ester represents a significant compound in the field of natural products and medicinal chemistry, with ongoing research aimed at elucidating its full range of biological activities and applications.
Formula:C26H34O9
InChI:InChI=1S/C26H34O9/c1-16(11-7-13-18(3)24(31)32)9-5-6-10-17(2)12-8-14-19(4)25(33)35-26-23(30)22(29)21(28)20(15-27)34-26/h5-14,20-23,26-30H,15H2,1-4H3,(H,31,32)/b6-5+,11-7+,12-8+,16-9+,17-10+,18-13+,19-14+/t20-,21-,22+,23-,26+/m1/s1
InChI key:InChIKey=ZVGODNZUEWDIPM-YXRLTKITSA-N
SMILES:O(C(/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C(O)=O)\C)\C)/C)/C)=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- Crocetin mono-β-D-glucosyl ester
- Crocetin glucosyl ester
- 8,8′-Diapo-ψ,ψ-carotenedioic acid, mono-β-D-glucopyranosyl ester
- β-D-Glucopyranose, 1-O-(15-carboxy-2,6,11-trimethyl-1-oxo-2,4,6,8,10,12,14-hexadecaheptaenyl)-, (all-E)-
- β-D-Glucopyranose, 1-[hydrogen (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedioate]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Crocin e
CAS:Natural glycosideFormula:C26H34O9Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:490.54Crocetin β-D-glucopyranoside
CAS:Crocetin β-D-glucopyranoside is a medicinal compound that has been shown to have anticancer properties. It is an analog of crocetin, a natural compound found in Chinese herbal medicine. Crocetin β-D-glucopyranoside has been shown to inhibit the growth of cancer cells by inducing apoptosis, or programmed cell death. This compound also acts as a protein kinase inhibitor, which may contribute to its ability to inhibit tumor growth. In human urine, Crocetin β-D-glucopyranoside has been detected as a potential biomarker for the early detection of cancer. Further research is needed to fully understand the potential therapeutic benefits of this promising compound.Formula:C26H34O9Purity:Min. 95%Molecular weight:490.5 g/mol


