CAS 58077-08-0
:2-azido-N-(2-benzoyl-4-nitro-phenyl)acetamide
Description:
2-Azido-N-(2-benzoyl-4-nitro-phenyl)acetamide is a chemical compound characterized by the presence of an azido group (-N3), which is known for its reactivity and potential use in click chemistry. This compound features an acetamide functional group, which contributes to its solubility and reactivity in various chemical reactions. The benzoyl and nitrophenyl substituents enhance its electronic properties, potentially making it useful in organic synthesis and as a precursor in the development of pharmaceuticals or materials. The nitro group (-NO2) is an electron-withdrawing group that can influence the compound's reactivity and stability. Additionally, the presence of the azido group suggests potential applications in the synthesis of more complex molecules through azide-alkyne cycloaddition reactions. Overall, this compound exhibits characteristics typical of azido compounds, including sensitivity to heat and shock, and requires careful handling in laboratory settings. Its unique structure makes it a valuable compound for research in organic chemistry and materials science.
Formula:C15H11N5O4
InChI:InChI=1/C15H11N5O4/c16-19-17-9-14(21)18-13-7-6-11(20(23)24)8-12(13)15(22)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,21)
SMILES:c1ccc(cc1)C(=O)c1cc(ccc1N=C(CN=[N+]=[NH-])O)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Azido-N-(2-benzoyl-4-nitrophenyl)acetamide
CAS:Controlled ProductApplications Intermediate for the preparation of Nitrazepam.
Formula:C15H11N5O4Color and Shape:NeatMolecular weight:325.28
