CAS 58088-57-6

(R)-phenyl(pyridin-4-yl)methanaminium

Description:

(R)-phenyl(pyridin-4-yl)methanaminium, with the CAS number 58088-57-6, is a chiral organic compound characterized by its amine functional group and the presence of both phenyl and pyridine moieties. This compound typically exhibits a positive charge due to the protonation of the amine group, making it a quaternary ammonium salt in certain contexts. Its chirality is derived from the specific arrangement of its substituents around the central carbon atom, which can influence its biological activity and interactions with other molecules. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry and its utility in various organic synthesis applications. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and reactivity can vary based on the solvent and conditions, which are important considerations for its practical applications in research and industry.

Formula: C₁₂H₁₃N₂

InChI: InChI=1/C12H12N2/c13-12(10-4-2-1-3-5-10)11-6-8-14-9-7-11/h1-9,12H,13H2/p+1/t12-/m1/s1

PHENYL-PYRIDIN-4-YLMETHYL-AMINE

CAS: 58088-57-6

Formula: C₁₂H₁₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 184.2371

Ref: IN-DA00EAV8

C-Phenyl-c-pyridin-4-yl-methylamine

CAS: 58088-57-6

C-Phenyl-c-pyridin-4-yl-methylamine

Purity: 95%

Molecular weight: 184.24g/mol

Ref: 54-OR951385

C-Phenyl-C-pyridin-4-yl-methylamine

CAS: 58088-57-6

Formula: C₁₂H₁₂N₂

Purity: 95%

Molecular weight: 184.242

Ref: 10-F055628