CymitQuimica logo

CAS 58091-08-0

:

N-(bis(methylthio)methylene)glycine methyl ester

Description:
N-(bis(methylthio)methylene)glycine methyl ester, with the CAS number 58091-08-0, is a chemical compound characterized by its unique structure that includes a glycine backbone modified with two methylthio groups and a methyl ester functional group. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the methylthio groups may impart specific reactivity and solubility characteristics, making it useful in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the methyl ester functionality can enhance its lipophilicity, potentially influencing its biological activity and interaction with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C6H11NO2S2
InChI:InChI=1/C6H11NO2S2/c1-9-5(8)4-7-6(10-2)11-3/h4H2,1-3H3
SMILES:COC(=O)CN=C(SC)SC
Synonyms:
  • methyl N-[bis(methylsulfanyl)methylidene]glycinate
  • N-[Bis(methylthio)methylene]glycine methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.