CAS 58092-40-3

3,3-bis(methylsulfanyl)-2-(phenylsulfonyl)prop-2-enenitrile

Description:

3,3-bis(methylsulfanyl)-2-(phenylsulfonyl)prop-2-enenitrile, with the CAS number 58092-40-3, is an organic compound characterized by its unique structure that includes a prop-2-enenitrile backbone substituted with both methylsulfanyl and phenylsulfonyl groups. This compound typically exhibits properties associated with nitriles, such as moderate polarity and potential reactivity due to the presence of the nitrile functional group. The methylsulfanyl groups contribute to its sulfur content, which can influence its reactivity and solubility in various solvents. The phenylsulfonyl moiety adds to the compound's stability and may enhance its interactions in biological systems or chemical reactions. Overall, this compound may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or agrochemicals, depending on its specific reactivity and biological activity. Its synthesis and handling would require standard safety precautions due to the presence of sulfur and nitrile functionalities, which can pose health risks.

Formula: C₁₁H₁₁NO₂S₃

InChI: InChI=1/C11H11NO2S3/c1-15-11(16-2)10(8-12)17(13,14)9-6-4-3-5-7-9/h3-7H,1-2H3

SMILES: CSC(=C(C#N)S(=O)(=O)c1ccccc1)SC

Synonyms:

• 2-(Benzenesulfonyl)-3,3-Bis(Methylsulfanyl)Acrylonitrile
• 2-Propenenitrile, 3,3-bis(methylthio)-2-(phenylsulfonyl)-

3,3-dimethylthio-2-(phenylsulfonyl)prop-2-enenitrile

CAS: 58092-40-3

3,3-dimethylthio-2-(phenylsulfonyl)prop-2-enenitrile is an experimental compound which is used in optical communications. It is a pyridinium salt that has a signal wavelength of 637 nm and a bandwidth of 2.5 GHz. This chemical can be used as an amplifier with a laser to produce radiation at the desired wavelength. 3,3-dimethylthio-2-(phenylsulfonyl)prop-2-enenitrile has been shown to have average optical power of 130 mW in the 1 cm cell length. The signal wavelength and bandwidth are also dependent on temperature and pressure.

Purity: Min. 95%

Ref: 3D-FD169786