CAS 5810-55-9: N-piperidin-3-ylacetamide

Description:N-piperidin-3-ylacetamide is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an acetamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to a piperidine moiety at the 3-position. The molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. N-piperidin-3-ylacetamide is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being soluble in polar organic solvents. The compound may exhibit properties such as moderate to high melting points and stability under standard laboratory conditions. Its chemical reactivity is influenced by the presence of the amide group, which can participate in hydrogen bonding and other interactions. Overall, N-piperidin-3-ylacetamide serves as a valuable building block in the synthesis of various pharmaceuticals and research compounds.

Formula:C₇H₁₄N₂O

InChI:InChI=1/C7H14N2O/c1-6(10)9-7-3-2-4-8-5-7/h7-8H,2-5H2,1H3,(H,9,10)

Synonyms:
acetamide, N-3-piperidinyl-
N-(piperidin-3-yl)acetamide
3-Acetamidopiperidine

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Acetamidopiperidine REF: 3B-A1934CAS: 5810-55-9	>99.0%(GC)(T)	273.00 €	Mon 07 Apr 25
3-ACETAMIDOPIPERIDINE REF: IN-DA003SF3CAS: 5810-55-9	99%	To inquire	Mon 14 Apr 25
3-Acetamidopiperidin REF: 4Z-P-147063CAS: 5810-55-9	- - -	To inquire	Mon 21 Apr 25
N-Piperidin-3-yl-acetamide REF: 10-F029239CAS: 5810-55-9	95.0%	To inquire	Thu 24 Apr 25
N-Piperidin-3-ylacetamide REF: 3D-FP117001CAS: 5810-55-9	Min. 95%	- - -	Discontinued product