CymitQuimica logo

CAS 58105-66-1

:

methyl 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate

Description:
Methyl 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate, with CAS number 58105-66-1, is a chemical compound characterized by its complex structure, which includes a benzoate moiety, an amino group, and a phenoxy group substituted with a chlorine atom and a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the chlorine substituent may impart unique electronic properties, affecting the compound's overall stability and reactivity. As with many synthetic organic compounds, safety and handling precautions should be observed, as it may pose risks such as toxicity or environmental hazards. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C15H11ClF3NO3
InChI:InChI=1/C15H11ClF3NO3/c1-22-14(21)10-7-9(3-4-12(10)20)23-13-5-2-8(6-11(13)16)15(17,18)19/h2-7H,20H2,1H3
SMILES:COC(=O)c1cc(ccc1N)Oc1ccc(cc1Cl)C(F)(F)F
Synonyms:
  • Benzoic acid, 2-amino-5-(2-chloro-4-(trifluoromethyl)phenoxy)-, methyl ester
  • Methyl 2-amino-5-(2-chloro-4-(trifluoromethyl)phenoxy)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.