CAS 58106-25-5
:1-bromo-4-methoxy-2,5-dimethylbenzene
Description:
1-Bromo-4-methoxy-2,5-dimethylbenzene, also known as a substituted aromatic compound, features a bromine atom and a methoxy group attached to a benzene ring that also bears two methyl groups. This compound is characterized by its relatively low molecular weight and moderate polarity due to the presence of the bromine and methoxy substituents. The bromine atom introduces a degree of electrophilicity, making it reactive in various chemical reactions, such as nucleophilic substitution. The methoxy group, being an electron-donating group, can influence the reactivity and stability of the compound, often enhancing its solubility in organic solvents. The presence of multiple methyl groups contributes to steric hindrance, which can affect the compound's reactivity and interaction with other molecules. In terms of physical properties, it is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. This compound can be utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals.
Formula:C9H11BrO
InChI:InChI=1/C9H11BrO/c1-6-5-9(11-3)7(2)4-8(6)10/h4-5H,1-3H3
SMILES:Cc1cc(c(C)cc1Br)OC
Synonyms:- 4-Bromo-2,5-dimethylanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-4-methoxy-2,5-dimethylbenzene
CAS:Formula:C9H11BrOPurity:97%Color and Shape:LiquidMolecular weight:215.08701-Bromo-4-methoxy-2,5-dimethylbenzene
CAS:1-Bromo-4-methoxy-2,5-dimethylbenzenePurity:98%Molecular weight:215.09g/mol1-Bromo-4-methoxy-2,5-dimethylbenzene
CAS:1-Bromo-4-methoxy-2,5-dimethylbenzene is a synthetic compound that stabilizes the nf-e2-related factor. This compound has shown to be effective in reducing pulmonary fibrosis in mice and may have potential as a therapeutic agent for cancer. 1-Bromo-4-methoxy-2,5-dimethylbenzene interacts with Keap1, which leads to luminescence properties and autophagy of lung cancer cells. It also induces proteasomal degradation of proteins and is resistant to antibiotics. 1-Bromo-4-methoxy-2,5-dimethylbenzene has been shown to inhibit Mycobacterium tuberculosis growth by preventing cell wall synthesis.Formula:C9H11BrOPurity:Min. 95%Molecular weight:215.09 g/mol



