CAS 581065-97-6

3-[[13-Oxo-15-(2-pyridinyldithio)-3,6,9-trioxa-12-azapentadec-1-yl]oxy]propanoic acid

Description:

3-[[13-Oxo-15-(2-pyridinyldithio)-3,6,9-trioxa-12-azapentadec-1-yl]oxy]propanoic acid, with CAS number 581065-97-6, is a complex organic compound characterized by its unique structural features, including a long aliphatic chain, multiple functional groups, and a pyridine moiety. The presence of the dithio group suggests potential reactivity and interactions with various biological systems, making it of interest in medicinal chemistry and drug design. The compound contains both ester and carboxylic acid functionalities, which may influence its solubility and reactivity in different environments. Its oxo and azapentadecane components contribute to its overall stability and potential for forming hydrogen bonds. The pyridine ring can enhance its biological activity, possibly allowing for interactions with specific receptors or enzymes. Overall, this compound's intricate structure and functional diversity suggest potential applications in pharmaceuticals, particularly in targeting specific biological pathways or as a scaffold for further chemical modifications.

Formula: C₁₉H₃₀N₂O₇S₂

InChI: InChI=1S/C19H30N2O7S2/c22-17(5-16-29-30-18-3-1-2-6-21-18)20-7-9-26-11-13-28-15-14-27-12-10-25-8-4-19(23)24/h1-3,6H,4-5,7-16H2,(H,20,22)(H,23,24)

InChI key: InChIKey=IJDPYTZOKIVWAN-UHFFFAOYSA-N

SMILES: S(SCCC(NCCOCCOCCOCCOCCC(O)=O)=O)C1=CC=CC=N1

Synonyms:

• 4,7,10,13-Tetraoxa-16-azanonadecanoic acid, 17-oxo-19-(2-pyridinyldithio)-
• Propanoic acid, 3-[[13-oxo-15-(2-pyridinyldithio)-3,6,9-trioxa-12-azapentadec-1-yl]oxy]-
• 3-[[13-Oxo-15-(2-pyridinyldithio)-3,6,9-trioxa-12-azapentadec-1-yl]oxy]propanoic acid

4,7,10,13-Tetraoxa-16-azanonadecanoic acid,17-oxo-19-(2-pyridinyldithio)-

CAS: 581065-97-6

Formula: C₁₉H₃₀N₂O₇S₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 462.5807

Ref: IN-DA00IACB

SPDP-PEG4-acid

CAS: 581065-97-6

Purity: 97%

Molecular weight: 462.15

Ref: 10-F554819

SPDP-PEG4-acid

CAS: 581065-97-6

SPDP-PEG4-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₉H₃₀N₂O₇S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 462.58

Ref: TM-T16916

m-dPEG®4-OH

CAS: 581065-97-6

m-dPEG®4-OH is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, m-dPEG®4-OH is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₁₉H₃₀N₂O₇S₂

Purity: Min. 95%

Molecular weight: 462.58 g/mol

Ref: 3D-DPG-6159