CAS 58107-62-3
:n-ethylpyrrolidine-2-carboxamide hydrochloride
Description:
N-ethylpyrrolidine-2-carboxamide hydrochloride is a chemical compound characterized by its structure, which includes a pyrrolidine ring substituted with an ethyl group and a carboxamide functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in research and pharmaceuticals. The presence of the carboxamide group contributes to its potential as a polar molecule, influencing its interactions in biological systems. N-ethylpyrrolidine-2-carboxamide hydrochloride may exhibit properties such as moderate to high stability under standard conditions, and it is likely to participate in hydrogen bonding due to the amide functionality. Its specific applications can vary, but it may be explored in the context of medicinal chemistry, particularly in the development of compounds with potential therapeutic effects. As with any chemical substance, proper handling and safety protocols should be observed, given its potential biological activity and the need for further research to fully understand its properties and effects.
Formula:C7H15ClN2O
InChI:1S/C7H14N2O.ClH/c1-2-8-7(10)6-4-3-5-9-6;/h6,9H,2-5H2,1H3,(H,8,10);1H
Synonyms:- H-Pro-NHEt・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-Pro-NHEt · HCl
CAS:The C-terminal residue of highly active GnRH agonists as buserelin or leuprorelin replacing the C-terminal Pro-Gly amide of the native peptide hormone.Formula:C7H14N2O·HClColor and Shape:WhiteMolecular weight:178.66(2S)-N-ethylpyrrolidine-2-carboxamide hydrochloride
CAS:Formula:C7H15ClN2OPurity:96%Color and Shape:SolidMolecular weight:178.6598L-Proline ethylamide hydrochloride
CAS:L-Proline ethylamide hydrochloride
Purity:97%Molecular weight:178.66g/molH-Pro-NHEt Hydrochloride
CAS:Controlled ProductApplications H-PRO-NHET HCL (cas# 58107-62-3) is a useful research chemical.
Formula:C7H14N2O·HClColor and Shape:NeatMolecular weight:178.66




