CAS 581076-60-0
:N-(4-Methyl-3-nitrophenyl)-4-[(4-methyl-1-piperazinyl)methyl]benzamide
Description:
N-(4-Methyl-3-nitrophenyl)-4-[(4-methyl-1-piperazinyl)methyl]benzamide, with the CAS number 581076-60-0, is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a piperazine moiety and a nitrophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the nitro group suggests it may participate in electrophilic reactions, while the piperazine ring can contribute to its pharmacological properties, including interactions with biological targets. Its molecular structure indicates potential for various applications, particularly in medicinal chemistry, where it may serve as a lead compound for drug development. Additionally, the presence of methyl groups can influence its lipophilicity and overall biological activity. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C20H24N4O3
InChI:InChI=1/C20H24N4O3/c1-15-3-8-18(13-19(15)24(26)27)21-20(25)17-6-4-16(5-7-17)14-23-11-9-22(2)10-12-23/h3-8,13H,9-12,14H2,1-2H3,(H,21,25)
InChI key:InChIKey=GHWOXPOJAZVXAK-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=C(CN2CCN(C)CC2)C=C1)C3=CC(N(=O)=O)=C(C)C=C3
Synonyms:- Benzamide, N-(4-methyl-3-nitrophenyl)-4-[(4-methyl-1-piperazinyl)methyl]-
- N-(4-Methyl-3-nitrophenyl)-4-[(4-methyl-1-piperazinyl)methyl]benzamide
- N-(3-Nitro-4-methyl-phenyl)-4-(4-methyl-piperazin-1-yl)-benzamide
- N-(4-METHYL-3-NITROPHENYL)-4-(4-METHYLPIPERAZINOMETHYL)BENZAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.