CAS 58109-33-4
:1,1,1,3,3-pentafluoro-2-(fluoromethoxy)-3-methoxypropane
Description:
1,1,1,3,3-pentafluoro-2-(fluoromethoxy)-3-methoxypropane, with the CAS number 58109-33-4, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms and methoxy groups. This compound is part of a class of substances known for their low surface tension and high thermal stability, making them useful in various applications, including as solvents and in specialty chemical formulations. The presence of fluorine atoms contributes to its chemical stability and resistance to degradation, while the methoxy groups can influence its solubility and reactivity. Typically, such compounds exhibit low volatility and are non-flammable, which enhances their safety profile in industrial settings. Additionally, they may have specific interactions with biological systems, necessitating careful handling and assessment of their environmental impact. Overall, 1,1,1,3,3-pentafluoro-2-(fluoromethoxy)-3-methoxypropane exemplifies the unique properties of fluorinated compounds, combining stability with potential utility in various chemical processes.
Formula:C5H6F6O2
InChI:InChI=1/C5H6F6O2/c1-12-5(10,11)3(13-2-6)4(7,8)9/h3H,2H2,1H3
SMILES:COC(C(C(F)(F)F)OCF)(F)F
Synonyms:- Propane, 1,1,1,3,3-Pentafluoro-2-(Fluoromethoxy)-3-Methoxy-
- 1,1,1,3,3-Pentafluoro-2-(fluoromethoxy)-3-methoxypropane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1,1,1,3,3-Pentafluoro-2-(fluoromethoxy)-3-methoxy-propane
CAS:Controlled ProductApplications 1,1,1,3,3-Pentafluoro-2-(fluoromethoxy)-3-methoxy-propane is fluorinated diether derivative of anestehtic sevoflurane treated with bromine trifluoride. 1,1,1,3,3-Pentafluoro-2-(fluoromethoxy)-3-methoxy-propane is a sedative/hypnotic in animal when administered I.V.
References Ruzika, J.A., et. al.: J. Fluorine Chem. 75, 191 (1995)Formula:C5H6F6O2Color and Shape:NeatMolecular weight:212.09
