CAS 58109-40-3
:Diphenyliodonium hexafluorophosphate
Description:
Diphenyliodonium hexafluorophosphate is an organoiodine compound characterized by its unique structure, which includes a diphenyliodonium cation paired with a hexafluorophosphate anion. This compound is typically a white to light yellow solid and is known for its stability and solubility in polar organic solvents. It serves as a photoinitiator in various polymerization processes, particularly in UV-curable systems, due to its ability to generate reactive species upon exposure to light. The hexafluorophosphate anion contributes to the compound's ionic character and enhances its solubility in organic media. Diphenyliodonium hexafluorophosphate is also notable for its low toxicity compared to other iodonium salts, making it a preferred choice in certain applications. Its reactivity and stability make it valuable in the fields of materials science and photochemistry, where it is utilized in the synthesis of advanced materials and coatings. Overall, this compound exemplifies the intersection of organometallic chemistry and practical applications in industrial processes.
Formula:C12H10I·F6P
InChI:InChI=1S/C12H10I.F6P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2,3,4,5)6/h1-10H;/q+1;-1
InChI key:InChIKey=DSSRLRJACJENEU-UHFFFAOYSA-N
SMILES:[P+5]([F-])([F-])([F-])([F-])([F-])[F-].[I+](C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Dpi Hfp
- Dpi Pf6
- Iodonium diphenyl hexafluorophosphate
- Iodonium, diphenyl-, hexafluorophosphate(1-)
- Iodonium, diphenyl-, hexafluorophosphate(1-) (1:1)
- Ith-Pi 810
- Phosphate(1-), hexafluoro-, diphenyliodonium
- Photoinitiator-810
- Diphenyliodonium hexafluorophosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Diphenyliodonium Hexafluorophosphate
CAS:Formula:C12H10F6IPPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:426.08Diphenyliodonium hexafluorophosphate, 98%
CAS:Diphenyliodonium hexafluorophosphate is used as cationic photoinitiator and photoacid generator. It acts as a catalyst for the photochemical polymerization of various monomers. Further, it used as arylating reagent as well as an oxidant in organic synthesis. This Thermo Scientific Chemicals brand p
Formula:C12H10IPurity:98%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:281.12Diphenyliodonium hexafluorophosphate
CAS:Formula:C12H10F6IPPurity:98%Color and Shape:SolidMolecular weight:426.0765Diphenyliodonium hexafluorophosphate
CAS:Diphenyliodonium hexafluorophosphatePurity:98%Color and Shape:SolidMolecular weight:426.08g/molDiphenyliodonium hexafluorophosphate
CAS:Formula:C12H10F6IPPurity:97%Color and Shape:SolidMolecular weight:426.081





