CAS 58112-93-9

2-(1-methyl-1H-benzimidazol-2-yl)-1-phenylethanone

Description:

2-(1-Methyl-1H-benzimidazol-2-yl)-1-phenylethanone, with the CAS number 58112-93-9, is an organic compound characterized by its unique structure, which includes a benzimidazole moiety and a phenyl group attached to an ethanone functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard conditions. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The presence of the benzimidazole ring suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound's molecular structure may allow for various chemical modifications, enhancing its utility in synthetic applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, 2-(1-methyl-1H-benzimidazol-2-yl)-1-phenylethanone represents a versatile structure in organic chemistry with potential applications in medicinal chemistry and material science.

Formula: C₁₆H₁₄N₂O

InChI: InChI=1/C16H14N2O/c1-18-14-10-6-5-9-13(14)17-16(18)11-15(19)12-7-3-2-4-8-12/h2-10H,11H2,1H3

SMILES: Cn1c2ccccc2nc1CC(=O)c1ccccc1

2-(1-Methyl-1H-1,3-benzodiazol-2-yl)-1-phenylethan-1-one

Controlled Product

CAS: 58112-93-9

2-(1-Methyl-1H-1,3-benzodiazol-2-yl)-1-phenylethanone is a phenylhydrazone that can initiate acylation reactions. The reaction of 2-(1-methyl-1H-1,3-benzodiazol-2-yl)-1phenylethanone with an acylating agent leads to an acylated product. This compound has been shown to undergo recyclization with sodium methoxide in methanol to form the corresponding hydroxamic acid.

Formula: C₁₆H₁₄N₂O

Purity: Min. 95%

Molecular weight: 250.29 g/mol

Ref: 3D-ICA11293