CymitQuimica logo

CAS 58113-36-3

:

Piperidine, 4-[bis(4-fluorophenyl)methylene]-

Description:
Piperidine, 4-[bis(4-fluorophenyl)methylene]- is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a bis(4-fluorophenyl)methylene group, indicating the presence of two 4-fluorophenyl groups connected by a methylene bridge at the 4-position of the piperidine ring. This structure contributes to its unique chemical properties, including potential biological activity and interactions due to the presence of fluorine atoms, which can enhance lipophilicity and influence the compound's reactivity. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its applications may span various fields, including medicinal chemistry and materials science, where it could serve as a building block for more complex molecules or as a potential pharmacophore in drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C18H17F2N
InChI:InChI=1S/C18H17F2N/c19-16-5-1-13(2-6-16)18(15-9-11-21-12-10-15)14-3-7-17(20)8-4-14/h1-8,21H,9-12H2
InChI key:KNNQGZBGAQFPCY-UHFFFAOYSA-N
SMILES:C1CNCCC1=C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F
Found 4 products.