CymitQuimica logo

CAS 58114-25-3

:

N,N-dimethylethanaminium chloride

Description:
N,N-Dimethylethanaminium chloride is a quaternary ammonium compound characterized by its structure, which includes a central nitrogen atom bonded to two methyl groups and an ethyl group, along with a chloride anion. This compound is typically a white crystalline solid that is soluble in water and polar solvents due to its ionic nature. It exhibits properties common to quaternary ammonium salts, such as being a surfactant and having antimicrobial activity. N,N-Dimethylethanaminium chloride is often used in various applications, including as a phase transfer catalyst, in the synthesis of other chemical compounds, and in biological research due to its ability to interact with biological membranes. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes. Overall, N,N-dimethylethanaminium chloride is a versatile chemical with significant utility in both industrial and research settings.
Formula:C4H12ClN
InChI:InChI=1/C4H11N.ClH/c1-4-5(2)3;/h4H2,1-3H3;1H
SMILES:CCN(C)C.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.