CAS 58123-57-2: 1-(quinolin-5-yl)methanamine

Description:1-(Quinolin-5-yl)methanamine, with the CAS number 58123-57-2, is an organic compound characterized by the presence of a quinoline moiety attached to a methanamine group. This compound features a quinoline ring, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring, contributing to its aromatic properties and potential biological activity. The methanamine group introduces an amine functional group, which can participate in hydrogen bonding and may influence the compound's solubility and reactivity. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of both the aromatic quinoline and the amine functional group suggests potential applications in drug development, particularly in the synthesis of bioactive molecules. Additionally, the compound's stability, reactivity, and interaction with biological systems can be influenced by factors such as pH and the presence of other functional groups in a molecular context. Overall, 1-(quinolin-5-yl)methanamine is a compound of interest for further research in various chemical and biological applications.

Formula:C₁₀H₁₀N₂

InChI:InChI=1/C10H10N2/c11-7-8-3-1-5-10-9(8)4-2-6-12-10/h1-6H,7,11H2

Synonyms:
5-Quinolinemethanamine
Quinolin-5-yl-methylamine
1-(Quinolin-5-yl)methanamine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
C-QUINOLIN-5-YL-METHYLAMINE REF: IN-DA00E9YLCAS: 58123-57-2	- - -	To inquire	Wed 16 Apr 25
1-Quinolin-5-yl methylamine REF: 10-F042971CAS: 58123-57-2	95.0%	To inquire	Mon 28 Apr 25
Quinolin-5-yl-methylamine REF: 3D-FQ51100CAS: 58123-57-2	Min. 95%	222.00 €~1,195.00 €	Fri 09 May 25
Quinolin-5-ylmethanamine REF: 10-F720512CAS: 58123-57-2	95+%	- - -	Discontinued product