CAS 58123-57-2
:1-(quinolin-5-yl)methanamine
Description:
1-(Quinolin-5-yl)methanamine, with the CAS number 58123-57-2, is an organic compound characterized by the presence of a quinoline moiety attached to a methanamine group. This compound features a quinoline ring, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring, contributing to its aromatic properties and potential biological activity. The methanamine group introduces an amine functional group, which can participate in hydrogen bonding and may influence the compound's solubility and reactivity. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of both the aromatic quinoline and the amine functional group suggests potential applications in drug development, particularly in the synthesis of bioactive molecules. Additionally, the compound's stability, reactivity, and interaction with biological systems can be influenced by factors such as pH and the presence of other functional groups in a molecular context. Overall, 1-(quinolin-5-yl)methanamine is a compound of interest for further research in various chemical and biological applications.
Formula:C10H10N2
InChI:InChI=1/C10H10N2/c11-7-8-3-1-5-10-9(8)4-2-6-12-10/h1-6H,7,11H2
SMILES:c1cc(CN)c2cccnc2c1
Synonyms:- 5-Quinolinemethanamine
- Quinolin-5-yl-methylamine
- 1-(Quinolin-5-yl)methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Quinolin-5-yl-methylamine
CAS:Quinolin-5-yl-methylamine is a fine chemical that is used as a research chemical. It can be used as a reagent and as a speciality chemical. This compound has a high quality and is versatile in its use. Quinolin-5-yl-methylamine can be used in the synthesis of complex compounds, such as pharmaceuticals, agrochemicals, and polymers. It is also an intermediate that can be used to create other useful compounds, such as building blocks or scaffolds. The CAS number for this compound is 58123-57-2.Formula:C10H10N2Purity:Min. 95%Color and Shape:SolidMolecular weight:158.2 g/mol1-Quinolin-5-yl methylamine
CAS:Formula:C10H10N2Purity:95.0%Color and Shape:Solid, Low Melting SolidMolecular weight:158.204


