CAS 58123-77-6

3-Hydroxy-4-iodobenzoic acid

Description:

3-Hydroxy-4-iodobenzoic acid, with the CAS number 58123-77-6, is an aromatic carboxylic acid characterized by the presence of a hydroxyl group and an iodine atom on a benzoic acid framework. This compound features a hydroxyl (-OH) group at the meta position and an iodine atom at the para position relative to the carboxylic acid (-COOH) group. It is typically a white to off-white solid that is soluble in polar solvents like water and alcohols, owing to its functional groups. The presence of the iodine atom can impart unique reactivity, making it useful in various organic synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the hydroxyl group contributes to its potential as a ligand in coordination chemistry. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Overall, 3-Hydroxy-4-iodobenzoic acid is a valuable compound in both research and industrial applications.

Formula: C₇H₅IO₃

InChI: InChI=1S/C7H5IO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)

InChI key: InChIKey=UABBBWVTEWIIMN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(O)=C(I)C=C1

Synonyms:

• Benzoic acid, 3-hydroxy-4-iodo-
• 3-Hydroxy-4-iodobenzoic acid

3-Hydroxy-4-iodobenzoic Acid

CAS: 58123-77-6

Formula: C₇H₅IO₃

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 264.02

Ref: 3B-H1496

3-Hydroxy-4-iodobenzoic acid

CAS: 58123-77-6

Formula: C₇H₅IO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.0173

Ref: IN-DA003JJN

3-Hydroxy-4-iodobenzoic acid

CAS: 58123-77-6

3-Hydroxy-4-iodobenzoic acid

Formula: C₇H₅IO₃

Purity: 97%

Color and Shape: off white powder

Molecular weight: 264.02g/mol

Ref: 54-OR25974

3-Hydroxy-4-iodobenzoic acid

CAS: 58123-77-6

Formula: C₇H₅IO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 264.018

Ref: 10-F078581