CAS 5813-81-0
:N-(2-amino-2-oxoethyl)benzamide
Description:
N-(2-amino-2-oxoethyl)benzamide, also known by its CAS number 5813-81-0, is an organic compound characterized by its amide functional group and an amino acid-like structure. This compound features a benzamide moiety, where a benzene ring is attached to a carbonyl group (C=O) linked to an amine (NH2) group. The presence of the 2-amino-2-oxoethyl side chain contributes to its potential biological activity, making it of interest in medicinal chemistry. Typically, compounds like this may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential reactivity due to the amino and carbonyl groups. Its structure suggests it may participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals or agrochemicals. Overall, N-(2-amino-2-oxoethyl)benzamide is a compound of interest due to its structural features and potential applications in various chemical and biological contexts.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c10-8(12)6-11-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12)(H,11,13)
Synonyms:- N1-(2-amino-2-oxoethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
