CAS 58138-74-2
:2-hydroxy-3,4-dimethylbenzoic acid
Description:
2-Hydroxy-3,4-dimethylbenzoic acid, also known as salicylic acid derivative, is an aromatic carboxylic acid characterized by the presence of both hydroxyl (-OH) and carboxylic acid (-COOH) functional groups. This compound features a benzene ring substituted with two methyl groups at the 3 and 4 positions and a hydroxyl group at the 2 position, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid that is soluble in organic solvents and exhibits moderate solubility in water. The presence of the hydroxyl group imparts acidity, allowing it to participate in various chemical reactions, including esterification and acylation. This compound may exhibit biological activity, making it of interest in pharmaceutical and cosmetic applications. Additionally, its structural features suggest potential for use in organic synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c1-5-3-4-7(9(11)12)8(10)6(5)2/h3-4,10H,1-2H3,(H,11,12)
SMILES:Cc1ccc(c(c1C)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-HYDROXY-3,4-DIMETHYL-BENZOIC ACID
CAS:Formula:C9H10O3Purity:97%Color and Shape:SolidMolecular weight:166.17392-Hydroxy-3,4-dimethylbenzoic acid
CAS:2-Hydroxy-3,4-dimethylbenzoic acidPurity:97%Molecular weight:166.18g/mol3,4-Dimethyl-2-hydroxybenzoic acid
CAS:3,4-Dimethyl-2-hydroxybenzoic acid is a pseudocumene derivative that is an energy source for pseudomonads. This compound is the most abundant of the 3,4-dimethylbenzoic acid isomers. It can be found in a number of techniques such as nuclear magnetic resonance and mass spectroscopy. The various 3,4-dimethylbenzoic acid isomers have been identified by their characteristic spectral data and magnetic resonance signals. The 3,4-dimethylbenzoic acid isomers are differentiated from each other by their different magnetic properties, which depend on their structure.
Formula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/molRef: 3D-ICA13874
Discontinued product



