CAS 58142-95-3
:5-chloro-8-nitroisoquinoline
Description:
5-Chloro-8-nitroisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 5-position and a nitro group at the 8-position contributes to its unique chemical properties. This compound typically appears as a yellow to orange solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dimethyl sulfoxide. The chlorine and nitro substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution and nucleophilic attack. Additionally, 5-chloro-8-nitroisoquinoline may exhibit biological activity, which has drawn interest in medicinal chemistry for potential applications in drug development. Its synthesis often involves multi-step organic reactions, and it is important to handle this compound with care due to the presence of the nitro group, which can be sensitive to reduction reactions. Overall, this compound serves as a valuable intermediate in organic synthesis and research.
Formula:C9H5ClN2O2
InChI:InChI=1/C9H5ClN2O2/c10-8-1-2-9(12(13)14)7-5-11-4-3-6(7)8/h1-5H
SMILES:c1cc(c2cnccc2c1Cl)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Chloro-8-nitroisoquinoline
CAS:<p>5-Chloro-8-nitroisoquinoline is a cytotoxic agent that belongs to the class of pyridopyrimidines. It is an amidation product of 8-nitroisoquinoline and 5-chloroacetaldehyde, which is prepared by condensation of nitrostyrene with acetone. 5-Chloro-8-nitroisoquinoline has anticancer activity against human cancer cells in vitro and in vivo. The mechanism of action is multidrug resistance, mediated by overexpression of P glycoprotein. This drug also inhibits the reductive activation of hypoxia inducible factor (HIF) alpha, which leads to its cytotoxicity.</p>Formula:C9H5ClN2O2Purity:Min. 95%Molecular weight:208.6 g/mol
