CymitQuimica logo

CAS 58161-67-4

:

2-(4-hydroxy-3,5-dimethoxybenzylidene)cyclopent-4-ene-1,3-dione

Description:
2-(4-hydroxy-3,5-dimethoxybenzylidene)cyclopent-4-ene-1,3-dione, with the CAS number 58161-67-4, is an organic compound characterized by its complex structure, which includes a cyclopentene ring and a benzylidene moiety. This compound features multiple functional groups, including hydroxyl and methoxy groups, which contribute to its chemical reactivity and potential biological activity. The presence of the hydroxyl group suggests the ability to form hydrogen bonds, enhancing solubility in polar solvents and influencing its interaction with biological systems. The methoxy groups can affect the electronic properties of the molecule, potentially enhancing its stability and reactivity. This compound may exhibit antioxidant properties and has been studied for its potential applications in pharmaceuticals and materials science. Its unique structure allows for various synthetic modifications, making it a subject of interest in organic synthesis and medicinal chemistry. Overall, the characteristics of this compound make it a valuable candidate for further research in diverse chemical applications.
Formula:C14H12O5
InChI:InChI=1/C14H12O5/c1-18-12-6-8(7-13(19-2)14(12)17)5-9-10(15)3-4-11(9)16/h3-7,17H,1-2H3
Synonyms:
  • 4-Cyclopentene-1,3-dione, 2-((4-hydroxy-3,5-dimethoxyphenyl)methylene)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.