CAS 5817-70-9

methyl benzylcarbamate

Description:

Methyl benzylcarbamate, with the CAS number 5817-70-9, is an organic compound that belongs to the class of carbamates. It is characterized by the presence of a methyl group and a benzyl group attached to a carbamate functional group. This compound typically appears as a colorless to pale yellow liquid with a faint aromatic odor. Methyl benzylcarbamate is known for its applications in the field of agriculture, particularly as an insect repellent and pesticide. It exhibits moderate solubility in organic solvents and is relatively stable under normal conditions. The compound's structure allows it to interact with biological systems, which can lead to varying degrees of toxicity depending on the exposure levels. Safety data sheets indicate that it should be handled with care, as it may cause irritation to the skin and eyes. Overall, methyl benzylcarbamate is a versatile chemical with specific applications, but it requires proper handling due to its potential health effects.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-12-9(11)10-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,10,11)

SMILES: COC(=NCc1ccccc1)O

(Phenylmethyl)-carbamic acid methyl ester

CAS: 5817-70-9

Formula: C₉H₁₁NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA00ED00

Methyl benzylcarbamate

CAS: 5817-70-9

Methyl benzylcarbamate

Purity: 98%

Molecular weight: 165.19g/mol

Ref: 54-OR1001836

Methyl benzylcarbamate

CAS: 5817-70-9

Formula: C₉H₁₁NO₂

Purity: 98%

Molecular weight: 165.192

Ref: 10-F540216

Methyl benzylcarbamate

CAS: 5817-70-9

Methyl benzylcarbamate (MBQ) is a synthetic compound that has the general chemical formula of CH2CH(NH2)COOH. It is a sulfamic acid which has been used as an organic solvent, in polymerization reactions, and in amide formation. MBQ can be synthesized by reacting methyl benzyl chloride with sodium sulfamate. The reaction mechanism for this chemical change is similar to the one that occurs in esterification reactions, except that the hydroxyl group on the methyl benzyl chloride reacts with the carboxylic acid group on sulfamic acid. The chemical reaction also produces water as a by-product. Density lipoproteins are proteins that are involved in lipid transport and metabolism. They are primarily synthesized by liver cells but can also be made by other cell types like macrophages or adipocytes. They have an important role in transporting lipids from peripheral tissues to the liver for metabolism and excretion and are regulated by

Formula: C₉H₁₁NO₂

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-FAA81770