CAS 58175-86-3
:(+)-Chloroquine
Description:
(+)-Chloroquine is a synthetic compound primarily known for its use as an antimalarial drug. It belongs to the class of 4-aminoquinolines and is characterized by its ability to interfere with the growth of parasites in the blood. The molecular formula of chloroquine is C18H26ClN3, and it features a chloro group, a quinoline ring, and a side chain that contributes to its pharmacological properties. The compound exhibits a basic nature due to the presence of a tertiary amine, which allows it to form salts with acids. (+)-Chloroquine is known for its immunomodulatory effects and has been investigated for potential use in treating autoimmune diseases. It is typically administered in its phosphate or sulfate salt forms to enhance solubility and bioavailability. The drug is generally well-absorbed and has a long half-life, allowing for once-daily dosing in many cases. However, it can have side effects, including gastrointestinal disturbances and potential retinal toxicity with long-term use. Its mechanism of action involves the accumulation of heme in the parasite, leading to its death.
Formula:C18H26ClN3
InChI:InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21)/t14-/m0/s1
InChI key:InChIKey=WHTVZRBIWZFKQO-AWEZNQCLSA-N
SMILES:N([C@H](CCCN(CC)CC)C)C=1C2=C(N=CC1)C=C(Cl)C=C2
Synonyms:- (+)-Chloroquine
- 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-, (S)-
- (S)-(+)-Chloroquine
- 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-, (4S)-
- (4S)-N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(+)-Chloroquine
CAS:(+)-Chloroquine, an aminoquinoline drug, inhibits the in vitro terminal glycosylation of angiotensin-converting enzyme 2 (ACE-2) [1].Formula:C18H26ClN3Color and Shape:SolidMolecular weight:319.87
