CAS 581813-17-4

3-Bromo-4-(trifluoromethyl)benzoic acid

Description:

3-Bromo-4-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzoic acid structure. The bromine substituent is located at the meta position relative to the carboxylic acid group, while the trifluoromethyl group is positioned at the para location. This compound exhibits both acidic and electrophilic properties due to the carboxylic acid functional group, which can donate protons in solution. The trifluoromethyl group significantly enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. Additionally, the presence of the bromine atom can provide opportunities for further chemical modifications, making it a valuable intermediate in organic synthesis. The compound is typically used in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₈H₄O₂BrF₃

InChI: InChI=1S/C8H4BrF3O2/c9-6-3-4(7(13)14)1-2-5(6)8(10,11)12/h1-3H,(H,13,14)

SMILES: c1cc(c(cc1C(=O)O)Br)C(F)(F)F

Synonyms:

• 3-Bromo-4-trifluoromethylbenzoic acid
• Benzoic acid, 3-bromo-4-(trifluoromethyl)-

3-Bromo-4-(trifluoromethyl)benzoic acid

CAS: 581813-17-4

Formula: C₈H₄BrF₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 269.0154

Ref: IN-DA003J15

3-Bromo-4-(trifluoromethyl)benzoic acid

CAS: 581813-17-4

3-Bromo-4-(trifluoromethyl)benzoic acid

Formula: C₈H₄BrF₃O₂

Purity: 97%

Color and Shape: off white to faint lemon. fine crystalline powder

Molecular weight: 269.02g/mol

Ref: 54-PC48524

3-Bromo-4-(trifluoromethyl)benzoic acid

CAS: 581813-17-4

Formula: C₈H₄BrF₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 269.017

Ref: 10-F091934