CAS 581813-22-1: α-Methyl-5-isoquinolineacetic acid

Description:α-Methyl-5-isoquinolineacetic acid is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a methyl group at the alpha position relative to the carboxylic acid functional group, contributing to its unique reactivity and potential biological activity. The presence of the isoquinoline moiety suggests that it may exhibit interesting pharmacological properties, as many isoquinoline derivatives are known for their roles in medicinal chemistry. The compound is likely to be a solid at room temperature, with solubility influenced by the presence of the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure may allow for interactions with various biological targets, making it a candidate for further research in drug development. Additionally, the compound's CAS number, 581813-22-1, facilitates its identification in chemical databases, aiding in the exploration of its properties and potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula:C₁₂H₁₁NO₂

InChI:InChI=1S/C12H11NO2/c1-8(12(14)15)10-4-2-3-9-7-13-6-5-11(9)10/h2-8H,1H3,(H,14,15)

InChI key:InChIKey=PMASUGZCKDDXNJ-UHFFFAOYSA-N

SMILES:O=C(O)C(C1=CC=CC=2C=NC=CC21)C

Synonyms:
α-Methyl-5-isoquinolineacetic acid
2-(Isoquinolin-5-yl)propanoic acid
5-Isoquinolineacetic acid, α-methyl-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-(Isoquinolin-5-yl)propanoic acid REF: 10-F683366CAS: 581813-22-1	95%	- - -	Discontinued product
	5-Isoquinolineacetic acid REF: 3D-GYA81322CAS: 581813-22-1	Min. 95%	- - -	Discontinued product