CAS 58186-71-3

5-Amino-2-hydroxybenzaldehyde

Description:

5-Amino-2-hydroxybenzaldehyde, also known as salicylaldehyde-5-amino, is an organic compound characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) attached to a benzaldehyde structure. This compound features a benzene ring with a formyl group (-CHO) at one position and an amino group at the meta position relative to the hydroxyl group. It is typically a white to light yellow crystalline solid that is soluble in polar solvents such as water and alcohols. The presence of the amino and hydroxyl groups contributes to its reactivity, making it useful in various chemical reactions, including those involving nucleophilic substitutions and condensation reactions. Additionally, 5-Amino-2-hydroxybenzaldehyde can serve as a precursor in the synthesis of dyes, pharmaceuticals, and other organic compounds. Its unique functional groups also allow it to participate in hydrogen bonding, influencing its physical properties and interactions in biological systems. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₇NO₂

InChI: InChI=1S/C7H7NO2/c8-6-1-2-7(10)5(3-6)4-9/h1-4,10H,8H2

InChI key: InChIKey=BHLZAJPXLXRFAO-UHFFFAOYSA-N

SMILES: C(=O)C1=C(O)C=CC(N)=C1

Synonyms:

• Benzaldehyde, 5-amino-2-hydroxy-
• 5-Amino-2-hydroxybenzaldehyde
• 5-Aminosalicylaldehyde