CAS 5819-61-4
:3-[(methylsulfinyl)methyl]-4-(octyloxy)aniline
Description:
3-[(Methylsulfinyl)methyl]-4-(octyloxy)aniline, with the CAS number 5819-61-4, is an organic compound characterized by its unique functional groups and structure. It features an aniline backbone, which is an aromatic amine, indicating the presence of an amino group (-NH2) attached to a benzene ring. The compound also contains a methylsulfinyl group, which introduces a sulfur atom bonded to a methyl group and contributes to its potential reactivity and solubility properties. Additionally, the presence of an octyloxy group suggests that the compound has hydrophobic characteristics, likely enhancing its solubility in organic solvents. This combination of functional groups may impart specific biological activities or interactions, making it of interest in various fields, including pharmaceuticals and materials science. The molecular structure indicates potential applications in drug development or as a surfactant, depending on its physicochemical properties. Overall, the compound's unique features stem from its diverse functional groups, which influence its chemical behavior and potential applications.
Formula:C16H27NO2S
InChI:InChI=1/C16H27NO2S/c1-3-4-5-6-7-8-11-19-16-10-9-15(17)12-14(16)13-20(2)18/h9-10,12H,3-8,11,13,17H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-Toluidine, α-(methylsulfinyl)-4-(octyloxy)-
CAS:<p>m-Toluidine, alpha-(methylsulfinyl)-4-(octyloxy)- is a bioactive chemical.</p>Formula:C16H27NO2SColor and Shape:SolidMolecular weight:297.46
