CAS 5819-82-9
:N-(5-amino-2-{[5-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)pentyl]oxy}benzyl)formamide
Description:
N-(5-amino-2-{[5-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)pentyl]oxy}benzyl)formamide, with the CAS number 5819-82-9, is a complex organic compound characterized by its unique structural features. It contains an amino group, a formamide functional group, and a dioxo-isoindole moiety, which contribute to its potential biological activity. The presence of the pentyl ether linkage suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. This compound may be of interest in medicinal chemistry due to its potential as a pharmacophore, possibly exhibiting activity against specific biological targets. Its molecular structure indicates that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Additionally, the presence of multiple functional groups may allow for further derivatization, enhancing its chemical versatility. Overall, this compound's characteristics suggest it could be a candidate for further research in drug development or other applications in organic synthesis.
Formula:C21H23N3O4
InChI:InChI=1/C21H23N3O4/c22-16-8-9-19(15(12-16)13-23-14-25)28-11-5-1-4-10-24-20(26)17-6-2-3-7-18(17)21(24)27/h2-3,6-9,12,14H,1,4-5,10-11,13,22H2,(H,23,25)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Formamide, N-(5-amino-2-((5-(1,3-dioxoisoindolin-2-yl)pentyl)oxy)benzyl)-
CAS:<p>Formamide, N-(5-amino-2-((5-(1,3-dioxoisoindolin-2-yl)pentyl)oxy)benzyl)- is a bioactive chemical.</p>Formula:C21H23N3O4Color and Shape:SolidMolecular weight:381.42
