CAS 58196-33-1
:7-Hydroxy-1,2,3,4-tetrahydroquinoline
Description:
7-Hydroxy-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety with a hydroxyl group at the 7-position. This compound is part of the tetrahydroquinoline family, which is known for its potential biological activities, including antioxidant and neuroprotective properties. The presence of the hydroxyl group enhances its solubility in polar solvents and may contribute to its reactivity and interaction with biological systems. It typically appears as a solid at room temperature and may exhibit moderate stability under standard conditions. The compound's molecular structure allows for various functionalizations, making it a subject of interest in medicinal chemistry and drug development. Additionally, its CAS number, 58196-33-1, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and databases. Overall, 7-Hydroxy-1,2,3,4-tetrahydroquinoline represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C9H11NO
InChI:InChI=1S/C9H11NO/c11-8-4-3-7-2-1-5-10-9(7)6-8/h3-4,6,10-11H,1-2,5H2
InChI key:InChIKey=HJJRGZMJZDSMDB-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=CC1)CCCN2
Synonyms:- 1,2,3,4-Tetrahydro-7-hydroxyquinoline
- 1,2,3,4-Tetrahydro-7-quinolinol
- 1,2,3,4-Tetrahydroquinolin-7-Ol
- 1,2,3,4-Tetrahydroquinolin-8-Ol
- 7-Quinolinol, 1,2,3,4-tetrahydro-
- 7-hydroxy-1,2,3,4-Tetrahydro-quinolin
- 7-Hydroxy-1,2,3,4-tetrahydroquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Hydroxy-1,2,3,4-tetrahydroquinoline
CAS:Formula:C9H11NOPurity:95%Color and Shape:SolidMolecular weight:149.18977-Hydroxy-1,2,3,4-tetrahydroquinoline
CAS:7-Hydroxy-1,2,3,4-tetrahydroquinolineFormula:C9H11NOPurity:98%Color and Shape: dark orannge crystalsMolecular weight:149.18973g/mol7-Hydroxy-1,2,3,4-tetrahydroquinoline
CAS:7-Hydroxy-1,2,3,4-tetrahydroquinoline (7OH-THQ) is a fluorophore that can be used to detect the presence of cancer cells. It is a linker and labile and can be synthesized from the lactam 7-hydroxypyrazolo-[4,3-a]pyridin-5(6H)-one. The synthesis of 7OH-THQ is possible by reacting 4-(dimethylamino)benzenesulfonyl chloride with 2,2'-dithiolethane in the presence of sodium hydroxide. 7OH-THQ has been shown to be effective as an anticancer drug in vitro assays for colon and breast cancer cells. It also has fluorescence properties that are sensitive to acidic conditions and pH levels.Formula:C9H11NOPurity:Min. 96 Area-%Color and Shape:PowderMolecular weight:149.19 g/mol7-Hydroxy-1,2,3,4-tetrahydroquinoline
CAS:Please enquire for more information about 7-Hydroxy-1,2,3,4-tetrahydroquinoline including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C9H11NOPurity:Min. 96.0 Area-%Molecular weight:149.19 g/mol7-Hydroxy-1,2,3,4-tetrahydroquinoline
CAS:Formula:C9H11NOPurity:95%Color and Shape:Solid, Yellow powderMolecular weight:149.193



