CAS 58199-49-8

(2Z)-6-chloro-3-methyl-1,3-benzothiazol-2(3H)-imine

Description:

(2Z)-6-chloro-3-methyl-1,3-benzothiazol-2(3H)-imine is a chemical compound characterized by its unique structural features, including a benzothiazole core, which is a bicyclic structure containing both sulfur and nitrogen atoms. This compound exhibits a Z configuration at the imine double bond, indicating specific stereochemistry that can influence its reactivity and interactions. The presence of a chlorine atom and a methyl group on the benzothiazole ring contributes to its chemical properties, potentially affecting its solubility, polarity, and biological activity. Compounds of this type may exhibit various biological activities, making them of interest in medicinal chemistry and drug development. Additionally, the benzothiazole moiety is known for its applications in dyes, pharmaceuticals, and agrochemicals. The compound's CAS number, 58199-49-8, serves as a unique identifier, facilitating its recognition in chemical databases and literature. Overall, (2Z)-6-chloro-3-methyl-1,3-benzothiazol-2(3H)-imine represents a class of compounds with diverse applications and significant chemical properties.

Formula: C₈H₇ClN₂S

InChI: InChI=1/C8H7ClN2S/c1-11-6-3-2-5(9)4-7(6)12-8(11)10/h2-4,10H,1H3/b10-8-

SMILES: Cn1c2ccc(cc2sc1=N)Cl

6-chloro-3-methylbenzo[d]thiazol-2(3H)-imine

CAS: 58199-49-8

Formula: C₈H₇ClN₂S

Purity: 95.0%

Molecular weight: 198.67

Ref: 10-F511698